C17H25N3O4 — CID 95772650
1-[1-(2-hydroxybenzoyl)piperidin-4-yl]-3-[(2R)-1-methoxypropan-2-yl]urea (PubChem CID 95772650) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[1-(2-hydroxybenzoyl)piperidin-4-yl]-3-[(2R)-1-methoxypropan-2-yl]urea.
| Compound Name | 1-[1-(2-hydroxybenzoyl)piperidin-4-yl]-3-[(2R)-1-methoxypropan-2-yl]urea |
|---|---|
| PubChem CID | 95772650 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[1-(2-hydroxybenzoyl)piperidin-4-yl]-3-[(2R)-1-methoxypropan-2-yl]urea |
| SMILES | COC[C@@H](C)NC(=O)NC1CCN(C(=O)c2ccccc2O)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-12(11-24-2)18-17(23)19-13-7-9-20(10-8-13)16(22)14-5-3-4-6-15(14)21/h3-6,12-13,21H,7-11H2,1-2H3,(H2,18,19,23)/t12-/m1/s1 |
| InChIKey | KPYVUSVDGLUIAH-GFCCVEGCSA-N |
| XLogP | 1.33 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |