C19H29NO5 — CID 95772717
[2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] 4-methoxybutanoate (PubChem CID 95772717) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is [2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] 4-methoxybutanoate.
| Compound Name | [2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] 4-methoxybutanoate |
|---|---|
| PubChem CID | 95772717 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [2-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] 4-methoxybutanoate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)c1ccccc1OC(=O)CCCOC |
| InChI | InChI=1S/C19H29NO5/c1-6-15(20-18(22)25-19(2,3)4)14-10-7-8-11-16(14)24-17(21)12-9-13-23-5/h7-8,10-11,15H,6,9,12-13H2,1-5H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | RRHFPRDVGVLTPH-HNNXBMFYSA-N |
| XLogP | 3.99 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|