C17H19N3O3 — CID 95773336
(5R)-7-[(1R,2R)-2-(3-methylphenyl)cyclopropanecarbonyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 95773336) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (5R)-7-[(1R,2R)-2-(3-methylphenyl)cyclopropanecarbonyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R)-7-[(1R,2R)-2-(3-methylphenyl)cyclopropanecarbonyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 95773336 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (5R)-7-[(1R,2R)-2-(3-methylphenyl)cyclopropanecarbonyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cc1cccc([C@@H]2C[C@H]2C(=O)N2CC[C@]3(C2)NC(=O)NC3=O)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-10-3-2-4-11(7-10)12-8-13(12)14(21)20-6-5-17(9-20)15(22)18-16(23)19-17/h2-4,7,12-13H,5-6,8-9H2,1H3,(H2,18,19,22,23)/t12-,13+,17+/m0/s1 |
| InChIKey | HPGAQBSVIYYDTN-OGHNNQOOSA-N |
| XLogP | 0.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|