C18H23N5O2 — CID 95773539
N-[3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)phenyl]-N'-[(2S)-3-methylbutan-2-yl]oxamide (PubChem CID 95773539) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)phenyl]-N'-[(2S)-3-methylbutan-2-yl]oxamide.
| Compound Name | N-[3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)phenyl]-N'-[(2S)-3-methylbutan-2-yl]oxamide |
|---|---|
| PubChem CID | 95773539 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)phenyl]-N'-[(2S)-3-methylbutan-2-yl]oxamide |
| SMILES | CC(C)[C@H](C)NC(=O)C(=O)Nc1cccc(-c2n[nH]c(C3CC3)n2)c1 |
| InChI | InChI=1S/C18H23N5O2/c1-10(2)11(3)19-17(24)18(25)20-14-6-4-5-13(9-14)16-21-15(22-23-16)12-7-8-12/h4-6,9-12H,7-8H2,1-3H3,(H,19,24)(H,20,25)(H,21,22,23)/t11-/m0/s1 |
| InChIKey | AHKMHUVWMRSLRZ-NSHDSACASA-N |
| XLogP | 2.45 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|