C13H13BrN2O3 — CID 95774951
cis-(1R,2S)-N-[1-(3-bromophenyl)cyclopropyl]-2-nitrocyclopropane-1-carboxamide (PubChem CID 95774951) has the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. Its IUPAC name is cis-(1R,2S)-N-[1-(3-bromophenyl)cyclopropyl]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[1-(3-bromophenyl)cyclopropyl]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95774951 |
| Molecular Formula | C13H13BrN2O3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | cis-(1R,2S)-N-[1-(3-bromophenyl)cyclopropyl]-2-nitrocyclopropane-1-carboxamide |
| SMILES | O=C(NC1(c2cccc(Br)c2)CC1)[C@@H]1C[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13BrN2O3/c14-9-3-1-2-8(6-9)13(4-5-13)15-12(17)10-7-11(10)16(18)19/h1-3,6,10-11H,4-5,7H2,(H,15,17)/t10-,11+/m1/s1 |
| InChIKey | XSFGSNNCEFUIRS-MNOVXSKESA-N |
| XLogP | 2.22 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|