C14H19N3O — CID 95775037
cyclopent-3-en-1-yl-[(3S)-3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 95775037) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[(3S)-3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[(3S)-3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95775037 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | cyclopent-3-en-1-yl-[(3S)-3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CC=CC1)N1CCC[C@H](c2ccn[nH]2)C1 |
| InChI | InChI=1S/C14H19N3O/c18-14(11-4-1-2-5-11)17-9-3-6-12(10-17)13-7-8-15-16-13/h1-2,7-8,11-12H,3-6,9-10H2,(H,15,16)/t12-/m0/s1 |
| InChIKey | ZCXMDOXWWNEING-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|