C15H13ClN2O2S — CID 95775212
2-N-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]thiophene-2,4-dicarboxamide (PubChem CID 95775212) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 2-N-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 95775212 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-N-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]thiophene-2,4-dicarboxamide |
| SMILES | NC(=O)c1csc(C(=O)N[C@H]2C[C@@H]2c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C15H13ClN2O2S/c16-10-3-1-2-8(4-10)11-6-12(11)18-15(20)13-5-9(7-21-13)14(17)19/h1-5,7,11-12H,6H2,(H2,17,19)(H,18,20)/t11-,12+/m1/s1 |
| InChIKey | AYLOVFBWKAQALV-NEPJUHHUSA-N |
| XLogP | 2.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |