C14H19N3O5 — CID 95775228
N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-2-(5-nitro-2-oxo-1-pyridinyl)acetamide (PubChem CID 95775228) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-2-(5-nitro-2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-2-(5-nitro-2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 95775228 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-2-(5-nitro-2-oxo-1-pyridinyl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])ccc1=O)NC[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H19N3O5/c18-12-4-2-1-3-10(12)7-15-13(19)9-16-8-11(17(21)22)5-6-14(16)20/h5-6,8,10,12,18H,1-4,7,9H2,(H,15,19)/t10-,12+/m1/s1 |
| InChIKey | NHFJTFMWGHWQDA-PWSUYJOCSA-N |
| XLogP | 0.42 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|