About (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide
(2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide (PubChem CID 95776079) has the molecular formula C16H20N4OS
and a molecular weight of 316.43 g/mol. Its IUPAC name is (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide |
| PubChem CID | 95776079 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide |
| SMILES | C[C@@H]1C[C@H](c2ccsc2)CN1[C@@H](C)C(=O)Nc1ncccn1 |
| InChI | InChI=1S/C16H20N4OS/c1-11-8-14(13-4-7-22-10-13)9-20(11)12(2)15(21)19-16-17-5-3-6-18-16/h3-7,10-12,14H,8-9H2,1-2H3,(H,17,18,19,21)/t11-,12+,14+/m1/s1 |
| InChIKey | GXLQJQVHDLMNBC-DYEKYZERSA-N |
| XLogP | 2.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide?
The IUPAC name of (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide (CID 95776079) is (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide.
What is the SMILES notation for (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide?
The canonical SMILES for (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide is C[C@@H]1C[C@H](c2ccsc2)CN1[C@@H](C)C(=O)Nc1ncccn1.
What is the InChIKey of (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide?
The InChIKey is GXLQJQVHDLMNBC-DYEKYZERSA-N. The full InChI is InChI=1S/C16H20N4OS/c1-11-8-14(13-4-7-22-10-13)9-20(11)12(2)15(21)19-16-17-5-3-6-18-16/h3-7,10-12,14H,8-9H2,1-2H3,(H,17,18,19,21)/t11-,12+,14+/m1/s1.
What are the key properties of (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide?
(2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide has a molecular weight of 316.43 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2R,4R)-2-methyl-4-thiophen-3-ylpyrrolidin-1-yl]-N-pyrimidin-2-ylpropanamide is sourced from PubChem (CID 95776079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).