C18H15F3N2O2 — CID 95776233
N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-N'-(3,4,5-trifluorophenyl)oxamide (PubChem CID 95776233) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-N'-(3,4,5-trifluorophenyl)oxamide.
| Compound Name | N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-N'-(3,4,5-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 95776233 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-N'-(3,4,5-trifluorophenyl)oxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)C(=O)N[C@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H15F3N2O2/c19-14-8-13(9-15(20)16(14)21)23-18(25)17(24)22-12-6-5-10-3-1-2-4-11(10)7-12/h1-4,8-9,12H,5-7H2,(H,22,24)(H,23,25)/t12-/m0/s1 |
| InChIKey | ZMBDVGHRQAGYGJ-LBPRGKRZSA-N |
| XLogP | 2.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|