C18H27N3O — CID 95776434
N-[(2R)-1-(4-phenylpiperazin-1-yl)propan-2-yl]pent-4-enamide (PubChem CID 95776434) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[(2R)-1-(4-phenylpiperazin-1-yl)propan-2-yl]pent-4-enamide.
| Compound Name | N-[(2R)-1-(4-phenylpiperazin-1-yl)propan-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 95776434 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-[(2R)-1-(4-phenylpiperazin-1-yl)propan-2-yl]pent-4-enamide |
| SMILES | C=CCCC(=O)N[C@H](C)CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O/c1-3-4-10-18(22)19-16(2)15-20-11-13-21(14-12-20)17-8-6-5-7-9-17/h3,5-9,16H,1,4,10-15H2,2H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | DIJJMJAUVCGBOE-MRXNPFEDSA-N |
| XLogP | 2.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|