C18H26BrNO4 — CID 95777233
methyl (2R)-2-(4-bromophenyl)-2-[2-methoxyethyl-[(2R)-2-methylpentanoyl]amino]acetate (PubChem CID 95777233) has the molecular formula C18H26BrNO4 and a molecular weight of 400.31 g/mol. Its IUPAC name is methyl (2R)-2-(4-bromophenyl)-2-[2-methoxyethyl-[(2R)-2-methylpentanoyl]amino]acetate.
| Compound Name | methyl (2R)-2-(4-bromophenyl)-2-[2-methoxyethyl-[(2R)-2-methylpentanoyl]amino]acetate |
|---|---|
| PubChem CID | 95777233 |
| Molecular Formula | C18H26BrNO4 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl (2R)-2-(4-bromophenyl)-2-[2-methoxyethyl-[(2R)-2-methylpentanoyl]amino]acetate |
| SMILES | CCC[C@@H](C)C(=O)N(CCOC)[C@@H](C(=O)OC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H26BrNO4/c1-5-6-13(2)17(21)20(11-12-23-3)16(18(22)24-4)14-7-9-15(19)10-8-14/h7-10,13,16H,5-6,11-12H2,1-4H3/t13-,16-/m1/s1 |
| InChIKey | GMZVRSMVKGABPV-CZUORRHYSA-N |
| XLogP | 3.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |