C20H29N3O2 — CID 95778593
(4S)-N-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-1-ethyl-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 95778593) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (4S)-N-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-1-ethyl-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | (4S)-N-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-1-ethyl-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 95778593 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (4S)-N-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-1-ethyl-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | CCOCc1cc(CN[C@H]2CCCc3c2cnn3CC)ccc1OC |
| InChI | InChI=1S/C20H29N3O2/c1-4-23-19-8-6-7-18(17(19)13-22-23)21-12-15-9-10-20(24-3)16(11-15)14-25-5-2/h9-11,13,18,21H,4-8,12,14H2,1-3H3/t18-/m0/s1 |
| InChIKey | YTAXPWNEDOHXAJ-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|