C6BrF5 — CID 9578
1-bromo-2,3,4,5,6-pentafluorobenzene (PubChem CID 9578) has the molecular formula C6BrF5 and a molecular weight of 246.96 g/mol. Its IUPAC name is 1-bromo-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-bromo-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 9578 |
| Molecular Formula | C6BrF5 |
| Molecular Weight | 246.96 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | 1-bromo-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C6BrF5/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | XEKTVXADUPBFOA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.96 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|