About methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate
methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate (PubChem CID 95780999) has the molecular formula C21H31NO5
and a molecular weight of 377.48 g/mol. Its IUPAC name is methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate |
| PubChem CID | 95780999 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate |
| SMILES | CCCCCC[C@@H](C)N(C(=O)[C@@H]1COCCO1)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C21H31NO5/c1-4-5-6-7-10-16(2)22(20(23)19-15-26-13-14-27-19)18-12-9-8-11-17(18)21(24)25-3/h8-9,11-12,16,19H,4-7,10,13-15H2,1-3H3/t16-,19+/m1/s1 |
| InChIKey | AIYODMVIAQDONZ-APWZRJJASA-N |
| XLogP | 3.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate?
The IUPAC name of methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate (CID 95780999) is methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate.
What is the SMILES notation for methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate?
The canonical SMILES for methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate is CCCCCC[C@@H](C)N(C(=O)[C@@H]1COCCO1)c1ccccc1C(=O)OC.
What is the InChIKey of methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate?
The InChIKey is AIYODMVIAQDONZ-APWZRJJASA-N. The full InChI is InChI=1S/C21H31NO5/c1-4-5-6-7-10-16(2)22(20(23)19-15-26-13-14-27-19)18-12-9-8-11-17(18)21(24)25-3/h8-9,11-12,16,19H,4-7,10,13-15H2,1-3H3/t16-,19+/m1/s1.
What are the key properties of methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate?
methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate has a molecular weight of 377.48 g/mol, XLogP of 3.58, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S)-1,4-dioxane-2-carbonyl]-[(2R)-octan-2-yl]amino]benzoate is sourced from PubChem (CID 95780999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).