C23H31FN2O4 — CID 95781327
(4S)-N-[3-[1-(1,3-dioxolan-2-yl)cycloheptyl]propyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 95781327) has the molecular formula C23H31FN2O4 and a molecular weight of 418.51 g/mol. Its IUPAC name is (4S)-N-[3-[1-(1,3-dioxolan-2-yl)cycloheptyl]propyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | (4S)-N-[3-[1-(1,3-dioxolan-2-yl)cycloheptyl]propyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 95781327 |
| Molecular Formula | C23H31FN2O4 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (4S)-N-[3-[1-(1,3-dioxolan-2-yl)cycloheptyl]propyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | O=C1C[C@H](C(=O)NCCCC2(C3OCCO3)CCCCCC2)c2ccc(F)cc2N1 |
| InChI | InChI=1S/C23H31FN2O4/c24-16-6-7-17-18(15-20(27)26-19(17)14-16)21(28)25-11-5-10-23(22-29-12-13-30-22)8-3-1-2-4-9-23/h6-7,14,18,22H,1-5,8-13,15H2,(H,25,28)(H,26,27)/t18-/m0/s1 |
| InChIKey | JAZUTBQMFUUVNV-SFHVURJKSA-N |
| XLogP | 3.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|