C15H16F3N3O2 — CID 95781672
1-methyl-3-[[(2S)-1-[2-(trifluoromethyl)phenoxy]propan-2-yl]amino]pyrazin-2-one (PubChem CID 95781672) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-methyl-3-[[(2S)-1-[2-(trifluoromethyl)phenoxy]propan-2-yl]amino]pyrazin-2-one.
| Compound Name | 1-methyl-3-[[(2S)-1-[2-(trifluoromethyl)phenoxy]propan-2-yl]amino]pyrazin-2-one |
|---|---|
| PubChem CID | 95781672 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-methyl-3-[[(2S)-1-[2-(trifluoromethyl)phenoxy]propan-2-yl]amino]pyrazin-2-one |
| SMILES | C[C@@H](COc1ccccc1C(F)(F)F)Nc1nccn(C)c1=O |
| InChI | InChI=1S/C15H16F3N3O2/c1-10(20-13-14(22)21(2)8-7-19-13)9-23-12-6-4-3-5-11(12)15(16,17)18/h3-8,10H,9H2,1-2H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | OATKRBKOCRHUQA-JTQLQIEISA-N |
| XLogP | 2.68 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |