About 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea
1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea (PubChem CID 95782080) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea.
Molecular Properties
| Compound Name | 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea |
| PubChem CID | 95782080 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)N(C[C@H]1C[C@H]1C)C(C)C |
| InChI | InChI=1S/C12H20N2O/c1-5-6-13-12(15)14(9(2)3)8-11-7-10(11)4/h1,9-11H,6-8H2,2-4H3,(H,13,15)/t10-,11-/m1/s1 |
| InChIKey | MZSQAQXVEACHNV-GHMZBOCLSA-N |
| XLogP | 1.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea?
The IUPAC name of 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea (CID 95782080) is 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea.
What is the SMILES notation for 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea?
The canonical SMILES for 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea is C#CCNC(=O)N(C[C@H]1C[C@H]1C)C(C)C.
What is the InChIKey of 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea?
The InChIKey is MZSQAQXVEACHNV-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H20N2O/c1-5-6-13-12(15)14(9(2)3)8-11-7-10(11)4/h1,9-11H,6-8H2,2-4H3,(H,13,15)/t10-,11-/m1/s1.
What are the key properties of 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea?
1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea has a molecular weight of 208.30 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1S,2R)-2-methylcyclopropyl]methyl]-1-propan-2-yl-3-prop-2-ynylurea is sourced from PubChem (CID 95782080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).