C22H34N2O — CID 95782518
1-[(3S)-3-[[ethyl(methyl)amino]methyl]pyrrolidin-1-yl]-2-(4-phenylcyclohexyl)ethanone (PubChem CID 95782518) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is 1-[(3S)-3-[[ethyl(methyl)amino]methyl]pyrrolidin-1-yl]-2-(4-phenylcyclohexyl)ethanone.
| Compound Name | 1-[(3S)-3-[[ethyl(methyl)amino]methyl]pyrrolidin-1-yl]-2-(4-phenylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 95782518 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 1-[(3S)-3-[[ethyl(methyl)amino]methyl]pyrrolidin-1-yl]-2-(4-phenylcyclohexyl)ethanone |
| SMILES | CCN(C)C[C@@H]1CCN(C(=O)CC2CCC(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H34N2O/c1-3-23(2)16-19-13-14-24(17-19)22(25)15-18-9-11-21(12-10-18)20-7-5-4-6-8-20/h4-8,18-19,21H,3,9-17H2,1-2H3/t18?,19-,21?/m0/s1 |
| InChIKey | WDLOGYMLZLZNOB-SCCNAQOGSA-N |
| XLogP | 4.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |