C20H39N3O5 — CID 95785445
tert-butyl 4-[(2S)-1-[3-(2-methoxyethoxy)propylamino]-1-oxopentan-2-yl]piperazine-1-carboxylate (PubChem CID 95785445) has the molecular formula C20H39N3O5 and a molecular weight of 401.55 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-1-[3-(2-methoxyethoxy)propylamino]-1-oxopentan-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-1-[3-(2-methoxyethoxy)propylamino]-1-oxopentan-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 95785445 |
| Molecular Formula | C20H39N3O5 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | tert-butyl 4-[(2S)-1-[3-(2-methoxyethoxy)propylamino]-1-oxopentan-2-yl]piperazine-1-carboxylate |
| SMILES | CCC[C@@H](C(=O)NCCCOCCOC)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H39N3O5/c1-6-8-17(18(24)21-9-7-14-27-16-15-26-5)22-10-12-23(13-11-22)19(25)28-20(2,3)4/h17H,6-16H2,1-5H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | FLXODIGXYHFIID-KRWDZBQOSA-N |
| XLogP | 1.88 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|