C21H34N2O4S — CID 95785521
N-[4-[3-[[(1S,5S)-1-(hydroxymethyl)-3,3,5-trimethylcyclohexyl]amino]propylsulfonyl]phenyl]acetamide (PubChem CID 95785521) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-[4-[3-[[(1S,5S)-1-(hydroxymethyl)-3,3,5-trimethylcyclohexyl]amino]propylsulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[3-[[(1S,5S)-1-(hydroxymethyl)-3,3,5-trimethylcyclohexyl]amino]propylsulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 95785521 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[4-[3-[[(1S,5S)-1-(hydroxymethyl)-3,3,5-trimethylcyclohexyl]amino]propylsulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)CCCN[C@@]2(CO)C[C@@H](C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C21H34N2O4S/c1-16-12-20(3,4)14-21(13-16,15-24)22-10-5-11-28(26,27)19-8-6-18(7-9-19)23-17(2)25/h6-9,16,22,24H,5,10-15H2,1-4H3,(H,23,25)/t16-,21-/m0/s1 |
| InChIKey | ZFAUECSUBIWDKN-KKSFZXQISA-N |
| XLogP | 2.98 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|