C26H29N3O3 — CID 95785630
(2R)-2-[4-[(3-hydroxyphenyl)methyl]piperazin-1-yl]-N-(3-methoxyphenyl)-2-phenylacetamide (PubChem CID 95785630) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is (2R)-2-[4-[(3-hydroxyphenyl)methyl]piperazin-1-yl]-N-(3-methoxyphenyl)-2-phenylacetamide.
| Compound Name | (2R)-2-[4-[(3-hydroxyphenyl)methyl]piperazin-1-yl]-N-(3-methoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 95785630 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (2R)-2-[4-[(3-hydroxyphenyl)methyl]piperazin-1-yl]-N-(3-methoxyphenyl)-2-phenylacetamide |
| SMILES | COc1cccc(NC(=O)[C@@H](c2ccccc2)N2CCN(Cc3cccc(O)c3)CC2)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-32-24-12-6-10-22(18-24)27-26(31)25(21-8-3-2-4-9-21)29-15-13-28(14-16-29)19-20-7-5-11-23(30)17-20/h2-12,17-18,25,30H,13-16,19H2,1H3,(H,27,31)/t25-/m1/s1 |
| InChIKey | WOSYZTDUGFOOIN-RUZDIDTESA-N |
| XLogP | 3.90 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |