C21H35N3O2 — CID 95785653
N-[2-(3-methylbutoxy)ethyl]-2-[methyl-[(3R)-1-phenylpiperidin-3-yl]amino]acetamide (PubChem CID 95785653) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is N-[2-(3-methylbutoxy)ethyl]-2-[methyl-[(3R)-1-phenylpiperidin-3-yl]amino]acetamide.
| Compound Name | N-[2-(3-methylbutoxy)ethyl]-2-[methyl-[(3R)-1-phenylpiperidin-3-yl]amino]acetamide |
|---|---|
| PubChem CID | 95785653 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | N-[2-(3-methylbutoxy)ethyl]-2-[methyl-[(3R)-1-phenylpiperidin-3-yl]amino]acetamide |
| SMILES | CC(C)CCOCCNC(=O)CN(C)[C@@H]1CCCN(c2ccccc2)C1 |
| InChI | InChI=1S/C21H35N3O2/c1-18(2)11-14-26-15-12-22-21(25)17-23(3)20-10-7-13-24(16-20)19-8-5-4-6-9-19/h4-6,8-9,18,20H,7,10-17H2,1-3H3,(H,22,25)/t20-/m1/s1 |
| InChIKey | OEJWNSFZJKPYSO-HXUWFJFHSA-N |
| XLogP | 2.77 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|