About ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate
ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate (PubChem CID 95786112) has the molecular formula C15H25NO5
and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate |
| PubChem CID | 95786112 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN([C@@H]2C[C@H](C(=O)OC)C[C@@H]2O)CC1 |
| InChI | InChI=1S/C15H25NO5/c1-3-21-15(19)10-4-6-16(7-5-10)12-8-11(9-13(12)17)14(18)20-2/h10-13,17H,3-9H2,1-2H3/t11-,12+,13-/m0/s1 |
| InChIKey | CPKFIAQAMFUTGG-XQQFMLRXSA-N |
| XLogP | 0.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate (CID 95786112) is ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate is CCOC(=O)C1CCN([C@@H]2C[C@H](C(=O)OC)C[C@@H]2O)CC1.
What is the InChIKey of ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate?
The InChIKey is CPKFIAQAMFUTGG-XQQFMLRXSA-N. The full InChI is InChI=1S/C15H25NO5/c1-3-21-15(19)10-4-6-16(7-5-10)12-8-11(9-13(12)17)14(18)20-2/h10-13,17H,3-9H2,1-2H3/t11-,12+,13-/m0/s1.
What are the key properties of ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate?
ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate has a molecular weight of 299.37 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(1R,2S,4S)-2-hydroxy-4-methoxycarbonylcyclopentyl]piperidine-4-carboxylate is sourced from PubChem (CID 95786112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).