C21H24N2O2 — CID 95786177
2-[(3S)-1-[(1R)-1-(3-methoxyphenyl)ethyl]piperidin-3-yl]-1,3-benzoxazole (PubChem CID 95786177) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[(3S)-1-[(1R)-1-(3-methoxyphenyl)ethyl]piperidin-3-yl]-1,3-benzoxazole.
| Compound Name | 2-[(3S)-1-[(1R)-1-(3-methoxyphenyl)ethyl]piperidin-3-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 95786177 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[(3S)-1-[(1R)-1-(3-methoxyphenyl)ethyl]piperidin-3-yl]-1,3-benzoxazole |
| SMILES | COc1cccc([C@@H](C)N2CCC[C@H](c3nc4ccccc4o3)C2)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-15(16-7-5-9-18(13-16)24-2)23-12-6-8-17(14-23)21-22-19-10-3-4-11-20(19)25-21/h3-5,7,9-11,13,15,17H,6,8,12,14H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | ZUJHOXBTSAZDJK-WBVHZDCISA-N |
| XLogP | 4.78 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |