C11H18N2O4 — CID 95786436
methyl (3S)-4-[2-(cyclopropylamino)-2-oxoethyl]morpholine-3-carboxylate (PubChem CID 95786436) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl (3S)-4-[2-(cyclopropylamino)-2-oxoethyl]morpholine-3-carboxylate.
| Compound Name | methyl (3S)-4-[2-(cyclopropylamino)-2-oxoethyl]morpholine-3-carboxylate |
|---|---|
| PubChem CID | 95786436 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methyl (3S)-4-[2-(cyclopropylamino)-2-oxoethyl]morpholine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1COCCN1CC(=O)NC1CC1 |
| InChI | InChI=1S/C11H18N2O4/c1-16-11(15)9-7-17-5-4-13(9)6-10(14)12-8-2-3-8/h8-9H,2-7H2,1H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | ZCRMJAMEJWLFHI-VIFPVBQESA-N |
| XLogP | -0.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |