About (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid
(2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid (PubChem CID 95786462) has the molecular formula C16H17NO6S
and a molecular weight of 351.38 g/mol. Its IUPAC name is (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid.
Molecular Properties
| Compound Name | (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid |
| PubChem CID | 95786462 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid |
| SMILES | COc1ccc(OC)c2c(S[C@H](CC(=O)O)C(=O)O)cc(C)nc12 |
| InChI | InChI=1S/C16H17NO6S/c1-8-6-11(24-12(16(20)21)7-13(18)19)14-9(22-2)4-5-10(23-3)15(14)17-8/h4-6,12H,7H2,1-3H3,(H,18,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | XGOKPMBFUAJUBG-GFCCVEGCSA-N |
| XLogP | 2.58 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid?
The IUPAC name of (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid (CID 95786462) is (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid.
What is the SMILES notation for (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid?
The canonical SMILES for (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid is COc1ccc(OC)c2c(S[C@H](CC(=O)O)C(=O)O)cc(C)nc12.
What is the InChIKey of (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid?
The InChIKey is XGOKPMBFUAJUBG-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H17NO6S/c1-8-6-11(24-12(16(20)21)7-13(18)19)14-9(22-2)4-5-10(23-3)15(14)17-8/h4-6,12H,7H2,1-3H3,(H,18,19)(H,20,21)/t12-/m1/s1.
What are the key properties of (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid?
(2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid has a molecular weight of 351.38 g/mol, XLogP of 2.58, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(5,8-dimethoxy-2-methylquinolin-4-yl)sulfanylbutanedioic acid is sourced from PubChem (CID 95786462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).