C14H10N2OS — CID 9578692
5-Isoxazolamine, N-(phenylmethylene)-3-(2-thienyl)- (PubChem CID 9578692) has the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. Its IUPAC name is (E)-1-phenyl-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)methanimine.
| Compound Name | 5-Isoxazolamine, N-(phenylmethylene)-3-(2-thienyl)- |
|---|---|
| PubChem CID | 9578692 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (E)-1-phenyl-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)methanimine |
| SMILES | C1=CC=C(C=C1)/C=N/C2=CC(=NO2)C3=CC=CS3 |
| InChI | InChI=1S/C14H10N2OS/c1-2-5-11(6-3-1)10-15-14-9-12(16-17-14)13-7-4-8-18-13/h1-10H/b15-10+ |
| InChIKey | MCXFSKUTQLANCS-XNTDXEJSSA-N |
| XLogP | 3.40 |
| TPSA | 66.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 292 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|