About benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate
benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate (PubChem CID 95787392) has the molecular formula C22H25N3O4S
and a molecular weight of 427.53 g/mol. Its IUPAC name is benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate.
Molecular Properties
| Compound Name | benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate |
| PubChem CID | 95787392 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N[C@@H](C)C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-15-21(17(3)25(4)23-15)30(27,28)24-16(2)22(26)29-20(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,16,20,24H,1-4H3/t16-/m0/s1 |
| InChIKey | OXTMLNHYEHPBSU-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate?
The IUPAC name of benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate (CID 95787392) is benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate.
What is the SMILES notation for benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate?
The canonical SMILES for benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate is Cc1nn(C)c(C)c1S(=O)(=O)N[C@@H](C)C(=O)OC(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate?
The InChIKey is OXTMLNHYEHPBSU-INIZCTEOSA-N. The full InChI is InChI=1S/C22H25N3O4S/c1-15-21(17(3)25(4)23-15)30(27,28)24-16(2)22(26)29-20(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,16,20,24H,1-4H3/t16-/m0/s1.
What are the key properties of benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate?
benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate has a molecular weight of 427.53 g/mol, XLogP of 3.04, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl (2S)-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoate is sourced from PubChem (CID 95787392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).