C18H32N2O4S — CID 95787517
5-[[[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]-methylamino]methyl]-N,N-dimethylfuran-2-sulfonamide (PubChem CID 95787517) has the molecular formula C18H32N2O4S and a molecular weight of 372.53 g/mol. Its IUPAC name is 5-[[[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]-methylamino]methyl]-N,N-dimethylfuran-2-sulfonamide.
| Compound Name | 5-[[[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]-methylamino]methyl]-N,N-dimethylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 95787517 |
| Molecular Formula | C18H32N2O4S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 5-[[[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]-methylamino]methyl]-N,N-dimethylfuran-2-sulfonamide |
| SMILES | CCCCO[C@@H]1C[C@@H](N(C)Cc2ccc(S(=O)(=O)N(C)C)o2)C1(C)C |
| InChI | InChI=1S/C18H32N2O4S/c1-7-8-11-23-16-12-15(18(16,2)3)20(6)13-14-9-10-17(24-14)25(21,22)19(4)5/h9-10,15-16H,7-8,11-13H2,1-6H3/t15-,16-/m1/s1 |
| InChIKey | HLRUFXBBDBJCKU-HZPDHXFCSA-N |
| XLogP | 2.95 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|