C19H17BrFN3O3 — CID 95787542
2-[(4R)-4-(5-bromo-2-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(3,5-dimethylphenyl)acetamide (PubChem CID 95787542) has the molecular formula C19H17BrFN3O3 and a molecular weight of 434.27 g/mol. Its IUPAC name is 2-[(4R)-4-(5-bromo-2-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-(5-bromo-2-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 95787542 |
| Molecular Formula | C19H17BrFN3O3 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 2-[(4R)-4-(5-bromo-2-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-(3,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CN2C(=O)N[C@H](c3cc(Br)ccc3F)C2=O)c1 |
| InChI | InChI=1S/C19H17BrFN3O3/c1-10-5-11(2)7-13(6-10)22-16(25)9-24-18(26)17(23-19(24)27)14-8-12(20)3-4-15(14)21/h3-8,17H,9H2,1-2H3,(H,22,25)(H,23,27)/t17-/m1/s1 |
| InChIKey | UHJDBWBSJJKOKJ-QGZVFWFLSA-N |
| XLogP | 3.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|