C12H19F3N4 — CID 95788204
(3S)-N-(3-pyrazol-1-ylpropyl)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine (PubChem CID 95788204) has the molecular formula C12H19F3N4 and a molecular weight of 276.31 g/mol. Its IUPAC name is (3S)-N-(3-pyrazol-1-ylpropyl)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-(3-pyrazol-1-ylpropyl)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 95788204 |
| Molecular Formula | C12H19F3N4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (3S)-N-(3-pyrazol-1-ylpropyl)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine |
| SMILES | FC(F)(F)CN1CC[C@H](NCCCn2cccn2)C1 |
| InChI | InChI=1S/C12H19F3N4/c13-12(14,15)10-18-8-3-11(9-18)16-4-1-6-19-7-2-5-17-19/h2,5,7,11,16H,1,3-4,6,8-10H2/t11-/m0/s1 |
| InChIKey | BKFSTAXVZNPEBW-NSHDSACASA-N |
| XLogP | 1.50 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|