C23H21N3OS — CID 95789617
(5S)-5-(4-methylphenyl)-2-oxo-N-phenyl-3,5-dihydro-1H-1,4-benzodiazepine-4-carbothioamide (PubChem CID 95789617) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is (5S)-5-(4-methylphenyl)-2-oxo-N-phenyl-3,5-dihydro-1H-1,4-benzodiazepine-4-carbothioamide.
| Compound Name | (5S)-5-(4-methylphenyl)-2-oxo-N-phenyl-3,5-dihydro-1H-1,4-benzodiazepine-4-carbothioamide |
|---|---|
| PubChem CID | 95789617 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (5S)-5-(4-methylphenyl)-2-oxo-N-phenyl-3,5-dihydro-1H-1,4-benzodiazepine-4-carbothioamide |
| SMILES | Cc1ccc([C@H]2c3ccccc3NC(=O)CN2C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3OS/c1-16-11-13-17(14-12-16)22-19-9-5-6-10-20(19)25-21(27)15-26(22)23(28)24-18-7-3-2-4-8-18/h2-14,22H,15H2,1H3,(H,24,28)(H,25,27)/t22-/m0/s1 |
| InChIKey | DNGCTHQTJBNJHI-QFIPXVFZSA-N |
| XLogP | 4.74 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|