About (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone
(1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone (PubChem CID 95790995) has the molecular formula C19H19N3O2
and a molecular weight of 321.38 g/mol. Its IUPAC name is (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone |
| PubChem CID | 95790995 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone |
| SMILES | O=C(c1cn(Cc2ccccc2)c2ncccc12)N1CCOCC1 |
| InChI | InChI=1S/C19H19N3O2/c23-19(21-9-11-24-12-10-21)17-14-22(13-15-5-2-1-3-6-15)18-16(17)7-4-8-20-18/h1-8,14H,9-13H2 |
| InChIKey | OGTXRTMLHFLRSD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone?
The IUPAC name of (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone (CID 95790995) is (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone.
What is the SMILES notation for (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone?
The canonical SMILES for (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone is O=C(c1cn(Cc2ccccc2)c2ncccc12)N1CCOCC1.
What is the InChIKey of (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone?
The InChIKey is OGTXRTMLHFLRSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2/c23-19(21-9-11-24-12-10-21)17-14-22(13-15-5-2-1-3-6-15)18-16(17)7-4-8-20-18/h1-8,14H,9-13H2.
What are the key properties of (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone?
(1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone has a molecular weight of 321.38 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpyrrolo[2,3-b]pyridin-3-yl)-morpholin-4-ylmethanone is sourced from PubChem (CID 95790995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).