C19H18BrN3O2 — CID 95795174
5-(3-bromophenyl)-N-[(1R)-1-(4-methoxyphenyl)ethyl]-1H-pyrazole-4-carboxamide (PubChem CID 95795174) has the molecular formula C19H18BrN3O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is 5-(3-bromophenyl)-N-[(1R)-1-(4-methoxyphenyl)ethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(3-bromophenyl)-N-[(1R)-1-(4-methoxyphenyl)ethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 95795174 |
| Molecular Formula | C19H18BrN3O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 5-(3-bromophenyl)-N-[(1R)-1-(4-methoxyphenyl)ethyl]-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)c2cn[nH]c2-c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C19H18BrN3O2/c1-12(13-6-8-16(25-2)9-7-13)22-19(24)17-11-21-23-18(17)14-4-3-5-15(20)10-14/h3-12H,1-2H3,(H,21,23)(H,22,24)/t12-/m1/s1 |
| InChIKey | BLSHJGSBELNKTR-GFCCVEGCSA-N |
| XLogP | 4.34 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |