C20H28N4O4 — CID 95797041
(3R,3'S)-N,N-dimethyl-5-oxo-1'-[2-oxo-2-(propan-2-ylamino)ethyl]spiro[2,4-dihydro-1,4-benzoxazepine-3,4'-pyrrolidine]-3'-carboxamide (PubChem CID 95797041) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is (3R,3'S)-N,N-dimethyl-5-oxo-1'-[2-oxo-2-(propan-2-ylamino)ethyl]spiro[2,4-dihydro-1,4-benzoxazepine-3,4'-pyrrolidine]-3'-carboxamide.
| Compound Name | (3R,3'S)-N,N-dimethyl-5-oxo-1'-[2-oxo-2-(propan-2-ylamino)ethyl]spiro[2,4-dihydro-1,4-benzoxazepine-3,4'-pyrrolidine]-3'-carboxamide |
|---|---|
| PubChem CID | 95797041 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (3R,3'S)-N,N-dimethyl-5-oxo-1'-[2-oxo-2-(propan-2-ylamino)ethyl]spiro[2,4-dihydro-1,4-benzoxazepine-3,4'-pyrrolidine]-3'-carboxamide |
| SMILES | CC(C)NC(=O)CN1C[C@H](C(=O)N(C)C)[C@]2(COc3ccccc3C(=O)N2)C1 |
| InChI | InChI=1S/C20H28N4O4/c1-13(2)21-17(25)10-24-9-15(19(27)23(3)4)20(11-24)12-28-16-8-6-5-7-14(16)18(26)22-20/h5-8,13,15H,9-12H2,1-4H3,(H,21,25)(H,22,26)/t15-,20-/m1/s1 |
| InChIKey | CGNUGXISNBLDCN-FOIQADDNSA-N |
| XLogP | 0.09 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |