C21H26N4O2S — CID 95797251
10-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]-4-methyl-7-prop-2-enyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 95797251) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 10-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]-4-methyl-7-prop-2-enyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]-4-methyl-7-prop-2-enyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 95797251 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 10-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]-4-methyl-7-prop-2-enyl-3-thia-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | C=CCn1c2cc(C)sc2c2cnn(CC(=O)N3[C@@H](C)CCC[C@@H]3C)c(=O)c21 |
| InChI | InChI=1S/C21H26N4O2S/c1-5-9-23-17-10-15(4)28-20(17)16-11-22-24(21(27)19(16)23)12-18(26)25-13(2)7-6-8-14(25)3/h5,10-11,13-14H,1,6-9,12H2,2-4H3/t13-,14-/m0/s1 |
| InChIKey | VDYOGRIRAHPUAE-KBPBESRZSA-N |
| XLogP | 3.70 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|