C21H23N5O4S — CID 95797642
[4-(6-methylsulfonyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(4-prop-2-enoxyphenyl)methanone (PubChem CID 95797642) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is [4-(6-methylsulfonyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(4-prop-2-enoxyphenyl)methanone.
| Compound Name | [4-(6-methylsulfonyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(4-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 95797642 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | [4-(6-methylsulfonyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperidin-1-yl]-(4-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1ccc(C(=O)N2CCC(c3c(S(C)(=O)=O)cnc4ncnn34)CC2)cc1 |
| InChI | InChI=1S/C21H23N5O4S/c1-3-12-30-17-6-4-16(5-7-17)20(27)25-10-8-15(9-11-25)19-18(31(2,28)29)13-22-21-23-14-24-26(19)21/h3-7,13-15H,1,8-12H2,2H3 |
| InChIKey | CKGIQNXNNFMTMH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|