C18H23N5O5S — CID 95797881
(3R,5R)-N-(1,3-benzodioxol-5-ylmethyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 95797881) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is (3R,5R)-N-(1,3-benzodioxol-5-ylmethyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5R)-N-(1,3-benzodioxol-5-ylmethyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 95797881 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (3R,5R)-N-(1,3-benzodioxol-5-ylmethyl)-5-(1,3-dimethylpyrazol-4-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | Cc1nn(C)cc1[C@H]1C[C@H](C(=O)NCc2ccc3c(c2)OCO3)N(C)S(=O)(=O)N1 |
| InChI | InChI=1S/C18H23N5O5S/c1-11-13(9-22(2)20-11)14-7-15(23(3)29(25,26)21-14)18(24)19-8-12-4-5-16-17(6-12)28-10-27-16/h4-6,9,14-15,21H,7-8,10H2,1-3H3,(H,19,24)/t14-,15-/m1/s1 |
| InChIKey | BHRVJOVYYRUYDD-HUUCEWRRSA-N |
| XLogP | 0.35 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |