C20H24N6O3 — CID 95798033
2-(7-ethyl-4-methyl-9-oxo-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-[3-(3-methylpyrazol-1-yl)propyl]acetamide (PubChem CID 95798033) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-(7-ethyl-4-methyl-9-oxo-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-[3-(3-methylpyrazol-1-yl)propyl]acetamide.
| Compound Name | 2-(7-ethyl-4-methyl-9-oxo-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-[3-(3-methylpyrazol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 95798033 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-(7-ethyl-4-methyl-9-oxo-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-[3-(3-methylpyrazol-1-yl)propyl]acetamide |
| SMILES | CCn1c2cc(C)oc2c2cnn(CC(=O)NCCCn3ccc(C)n3)c(=O)c21 |
| InChI | InChI=1S/C20H24N6O3/c1-4-25-16-10-14(3)29-19(16)15-11-22-26(20(28)18(15)25)12-17(27)21-7-5-8-24-9-6-13(2)23-24/h6,9-11H,4-5,7-8,12H2,1-3H3,(H,21,27) |
| InChIKey | GNJHXHUESBOCHM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|