C20H24N6O3 — CID 95798822
N-(2-methoxyethyl)-2-[5-(2-methylphenyl)-8-oxo-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3-trien-7-yl]acetamide (PubChem CID 95798822) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[5-(2-methylphenyl)-8-oxo-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3-trien-7-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[5-(2-methylphenyl)-8-oxo-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3-trien-7-yl]acetamide |
|---|---|
| PubChem CID | 95798822 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-(2-methoxyethyl)-2-[5-(2-methylphenyl)-8-oxo-4,5,7,9,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3-trien-7-yl]acetamide |
| SMILES | COCCNC(=O)CN1C(=O)N2CCCN=C2c2cnn(-c3ccccc3C)c21 |
| InChI | InChI=1S/C20H24N6O3/c1-14-6-3-4-7-16(14)26-19-15(12-23-26)18-22-8-5-10-24(18)20(28)25(19)13-17(27)21-9-11-29-2/h3-4,6-7,12H,5,8-11,13H2,1-2H3,(H,21,27) |
| InChIKey | NLMLTVSQVVXCDU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|