C22H28N4O2 — CID 95798943
(4aR,8aR)-2-[5,6-dimethyl-2-(2-methylfuran-3-yl)pyrazolo[1,5-a]pyrimidin-7-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 95798943) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (4aR,8aR)-2-[5,6-dimethyl-2-(2-methylfuran-3-yl)pyrazolo[1,5-a]pyrimidin-7-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | (4aR,8aR)-2-[5,6-dimethyl-2-(2-methylfuran-3-yl)pyrazolo[1,5-a]pyrimidin-7-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 95798943 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (4aR,8aR)-2-[5,6-dimethyl-2-(2-methylfuran-3-yl)pyrazolo[1,5-a]pyrimidin-7-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | Cc1nc2cc(-c3ccoc3C)nn2c(N2CC[C@]3(O)CCCC[C@@H]3C2)c1C |
| InChI | InChI=1S/C22H28N4O2/c1-14-15(2)23-20-12-19(18-7-11-28-16(18)3)24-26(20)21(14)25-10-9-22(27)8-5-4-6-17(22)13-25/h7,11-12,17,27H,4-6,8-10,13H2,1-3H3/t17-,22-/m1/s1 |
| InChIKey | RCHIUCZXGJVPHX-VGOFRKELSA-N |
| XLogP | 4.05 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |