About N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine
N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 95798960) has the molecular formula C18H28N4O2
and a molecular weight of 332.45 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 95798960 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCOCCCNc1c(C)c(C)nc2cc(C3CCOCC3)nn12 |
| InChI | InChI=1S/C18H28N4O2/c1-4-23-9-5-8-19-18-13(2)14(3)20-17-12-16(21-22(17)18)15-6-10-24-11-7-15/h12,15,19H,4-11H2,1-3H3 |
| InChIKey | MMINUALHNYPMAA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine (CID 95798960) is N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine is CCOCCCNc1c(C)c(C)nc2cc(C3CCOCC3)nn12.
What is the InChIKey of N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is MMINUALHNYPMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O2/c1-4-23-9-5-8-19-18-13(2)14(3)20-17-12-16(21-22(17)18)15-6-10-24-11-7-15/h12,15,19H,4-11H2,1-3H3.
What are the key properties of N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 332.45 g/mol, XLogP of 3.08, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxypropyl)-5,6-dimethyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 95798960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).