C22H27N5O — CID 95799029
2-[N-methyl-4-[[(1R,12S)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methyl]anilino]ethanol (PubChem CID 95799029) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[N-methyl-4-[[(1R,12S)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methyl]anilino]ethanol.
| Compound Name | 2-[N-methyl-4-[[(1R,12S)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methyl]anilino]ethanol |
|---|---|
| PubChem CID | 95799029 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-[N-methyl-4-[[(1R,12S)-7-methyl-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraen-15-yl]methyl]anilino]ethanol |
| SMILES | Cc1cc2ncc3c(n2n1)C[C@@H]1CC[C@H]3N1Cc1ccc(N(C)CCO)cc1 |
| InChI | InChI=1S/C22H27N5O/c1-15-11-22-23-13-19-20-8-7-18(12-21(19)27(22)24-15)26(20)14-16-3-5-17(6-4-16)25(2)9-10-28/h3-6,11,13,18,20,28H,7-10,12,14H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | GTXPVXIKKUMOOW-AZUAARDMSA-N |
| XLogP | 2.73 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|