C19H18F2N2O2 — CID 95799343
(2-fluorophenyl)-[(1S,5R)-3-(2-fluoro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 95799343) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is (2-fluorophenyl)-[(1S,5R)-3-(2-fluoro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | (2-fluorophenyl)-[(1S,5R)-3-(2-fluoro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 95799343 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2-fluorophenyl)-[(1S,5R)-3-(2-fluoro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | O=C(c1ccccc1F)N1[C@@H]2CC[C@H]1CC(O)(c1cccnc1F)C2 |
| InChI | InChI=1S/C19H18F2N2O2/c20-16-6-2-1-4-14(16)18(24)23-12-7-8-13(23)11-19(25,10-12)15-5-3-9-22-17(15)21/h1-6,9,12-13,25H,7-8,10-11H2/t12-,13+,19? |
| InChIKey | UHRDMKWMDNAAAK-ZHZUQJFRSA-N |
| XLogP | 3.01 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|