C22H27FN2O3S — CID 95799356
(1R,5S)-8-(4-tert-butylphenyl)sulfonyl-3-(2-fluoro-3-pyridinyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 95799356) has the molecular formula C22H27FN2O3S and a molecular weight of 418.53 g/mol. Its IUPAC name is (1R,5S)-8-(4-tert-butylphenyl)sulfonyl-3-(2-fluoro-3-pyridinyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,5S)-8-(4-tert-butylphenyl)sulfonyl-3-(2-fluoro-3-pyridinyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 95799356 |
| Molecular Formula | C22H27FN2O3S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (1R,5S)-8-(4-tert-butylphenyl)sulfonyl-3-(2-fluoro-3-pyridinyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2[C@@H]3CC[C@H]2CC(O)(c2cccnc2F)C3)cc1 |
| InChI | InChI=1S/C22H27FN2O3S/c1-21(2,3)15-6-10-18(11-7-15)29(27,28)25-16-8-9-17(25)14-22(26,13-16)19-5-4-12-24-20(19)23/h4-7,10-12,16-17,26H,8-9,13-14H2,1-3H3/t16-,17+,22? |
| InChIKey | RJYPDWLXMJZUBY-AQKKSAQBSA-N |
| XLogP | 3.72 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|