C19H20N6S — CID 95800124
(8aR)-2-(5-pyrazin-2-yl-4-thiophen-2-ylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 95800124) has the molecular formula C19H20N6S and a molecular weight of 364.48 g/mol. Its IUPAC name is (8aR)-2-(5-pyrazin-2-yl-4-thiophen-2-ylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (8aR)-2-(5-pyrazin-2-yl-4-thiophen-2-ylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 95800124 |
| Molecular Formula | C19H20N6S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (8aR)-2-(5-pyrazin-2-yl-4-thiophen-2-ylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | c1csc(-c2nc(N3CCN4CCC[C@@H]4C3)ncc2-c2cnccn2)c1 |
| InChI | InChI=1S/C19H20N6S/c1-3-14-13-25(9-8-24(14)7-1)19-22-11-15(16-12-20-5-6-21-16)18(23-19)17-4-2-10-26-17/h2,4-6,10-12,14H,1,3,7-9,13H2/t14-/m1/s1 |
| InChIKey | PQAKSEUXALGPCK-CQSZACIVSA-N |
| XLogP | 2.95 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |