C23H23FN2O3 — CID 95800433
(1'R,2S,2'S,4'R)-N-[(2-fluorophenyl)methyl]-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide (PubChem CID 95800433) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is (1'R,2S,2'S,4'R)-N-[(2-fluorophenyl)methyl]-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide.
| Compound Name | (1'R,2S,2'S,4'R)-N-[(2-fluorophenyl)methyl]-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
|---|---|
| PubChem CID | 95800433 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (1'R,2S,2'S,4'R)-N-[(2-fluorophenyl)methyl]-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
| SMILES | O=C1N[C@@]2(C[C@H]3CC[C@@H]2C[C@@H]3C(=O)NCc2ccccc2F)Oc2ccccc21 |
| InChI | InChI=1S/C23H23FN2O3/c24-19-7-3-1-5-15(19)13-25-21(27)18-11-16-10-9-14(18)12-23(16)26-22(28)17-6-2-4-8-20(17)29-23/h1-8,14,16,18H,9-13H2,(H,25,27)(H,26,28)/t14-,16-,18+,23+/m1/s1 |
| InChIKey | HQYUEELUCKICAH-LDMYIKCASA-N |
| XLogP | 3.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |