C23H26N2O5 — CID 95800527
methyl (2R)-1-[(1'S,2S,2'S,4'S)-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carbonyl]-2,5-dihydropyrrole-2-carboxylate (PubChem CID 95800527) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is methyl (2R)-1-[(1'S,2S,2'S,4'S)-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carbonyl]-2,5-dihydropyrrole-2-carboxylate.
| Compound Name | methyl (2R)-1-[(1'S,2S,2'S,4'S)-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carbonyl]-2,5-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 95800527 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | methyl (2R)-1-[(1'S,2S,2'S,4'S)-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carbonyl]-2,5-dihydropyrrole-2-carboxylate |
| SMILES | COC(=O)[C@H]1C=CCN1C(=O)[C@H]1C[C@@H]2CC[C@@]1(C)C[C@@]21NC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C23H26N2O5/c1-22-10-9-14(12-16(22)20(27)25-11-5-7-17(25)21(28)29-2)23(13-22)24-19(26)15-6-3-4-8-18(15)30-23/h3-8,14,16-17H,9-13H2,1-2H3,(H,24,26)/t14-,16+,17+,22-,23-/m0/s1 |
| InChIKey | QVIPMWWLZHLPJR-LWUZCHFKSA-N |
| XLogP | 2.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|