C23H24FNO3 — CID 95801145
methyl (1S,2S,5R)-8-benzyl-2-[(4-fluorophenyl)methyl]-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 95801145) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl (1S,2S,5R)-8-benzyl-2-[(4-fluorophenyl)methyl]-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1S,2S,5R)-8-benzyl-2-[(4-fluorophenyl)methyl]-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 95801145 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | methyl (1S,2S,5R)-8-benzyl-2-[(4-fluorophenyl)methyl]-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccc(F)cc2)C(=O)C[C@H]2CC[C@@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C23H24FNO3/c1-28-22(27)23(14-16-7-9-18(24)10-8-16)20-12-11-19(13-21(23)26)25(20)15-17-5-3-2-4-6-17/h2-10,19-20H,11-15H2,1H3/t19-,20+,23+/m1/s1 |
| InChIKey | SYYQGPPOANIFCN-QTEQDKRBSA-N |
| XLogP | 3.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|